C14H14F2N4 — CID 176984928
N-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-yl]methanimine (PubChem CID 176984928) has the molecular formula C14H14F2N4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-yl]methanimine.
| Compound Name | N-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-yl]methanimine |
|---|---|
| PubChem CID | 176984928 |
| Molecular Formula | C14H14F2N4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-yl]methanimine |
| SMILES | C=NN1CCc2cc(-c3cnn(C)c3)c(C(F)F)cc21 |
| InChI | InChI=1S/C14H14F2N4/c1-17-20-4-3-9-5-11(10-7-18-19(2)8-10)12(14(15)16)6-13(9)20/h5-8,14H,1,3-4H2,2H3 |
| InChIKey | DTQBBOFCRDRUFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|