About 3-butan-2-yl-1,2,4-triazine-6-carboxamide
3-butan-2-yl-1,2,4-triazine-6-carboxamide (PubChem CID 176985518) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-butan-2-yl-1,2,4-triazine-6-carboxamide.
Molecular Properties
| Compound Name | 3-butan-2-yl-1,2,4-triazine-6-carboxamide |
| PubChem CID | 176985518 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 3-butan-2-yl-1,2,4-triazine-6-carboxamide |
| SMILES | CCC(C)c1ncc(C(N)=O)nn1 |
| InChI | InChI=1S/C8H12N4O/c1-3-5(2)8-10-4-6(7(9)13)11-12-8/h4-5H,3H2,1-2H3,(H2,9,13) |
| InChIKey | MUUNEQHKTRVZRJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butan-2-yl-1,2,4-triazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1,2,4-triazine-6-carboxamide?
The IUPAC name of 3-butan-2-yl-1,2,4-triazine-6-carboxamide (CID 176985518) is 3-butan-2-yl-1,2,4-triazine-6-carboxamide.
What is the SMILES notation for 3-butan-2-yl-1,2,4-triazine-6-carboxamide?
The canonical SMILES for 3-butan-2-yl-1,2,4-triazine-6-carboxamide is CCC(C)c1ncc(C(N)=O)nn1.
What is the InChIKey of 3-butan-2-yl-1,2,4-triazine-6-carboxamide?
The InChIKey is MUUNEQHKTRVZRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-3-5(2)8-10-4-6(7(9)13)11-12-8/h4-5H,3H2,1-2H3,(H2,9,13).
What are the key properties of 3-butan-2-yl-1,2,4-triazine-6-carboxamide?
3-butan-2-yl-1,2,4-triazine-6-carboxamide has a molecular weight of 180.21 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1,2,4-triazine-6-carboxamide is sourced from PubChem (CID 176985518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).