C14H20F2N2 — CID 176985611
(3Z,5E)-5-(difluoromethyl)-4-ethenyl-7-methyliminodeca-1,3,5-trien-3-amine (PubChem CID 176985611) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is (3Z,5E)-5-(difluoromethyl)-4-ethenyl-7-methyliminodeca-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-5-(difluoromethyl)-4-ethenyl-7-methyliminodeca-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 176985611 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (3Z,5E)-5-(difluoromethyl)-4-ethenyl-7-methyliminodeca-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(C=C)/C(=C\C(CCC)=N\C)C(F)F |
| InChI | InChI=1S/C14H20F2N2/c1-5-8-10(18-4)9-12(14(15)16)11(6-2)13(17)7-3/h6-7,9,14H,2-3,5,8,17H2,1,4H3/b12-9+,13-11-,18-10+ |
| InChIKey | BJGGGVHOPBIVBT-RKSCBEAZSA-N |
| XLogP | 3.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|