C24H29N3O — CID 176985927
N-[4-(4-cyano-N,3-dimethylanilino)cyclohexyl]-4-ethylbenzamide (PubChem CID 176985927) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[4-(4-cyano-N,3-dimethylanilino)cyclohexyl]-4-ethylbenzamide.
| Compound Name | N-[4-(4-cyano-N,3-dimethylanilino)cyclohexyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 176985927 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[4-(4-cyano-N,3-dimethylanilino)cyclohexyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC2CCC(N(C)c3ccc(C#N)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-4-18-5-7-19(8-6-18)24(28)26-21-10-13-22(14-11-21)27(3)23-12-9-20(16-25)17(2)15-23/h5-9,12,15,21-22H,4,10-11,13-14H2,1-3H3,(H,26,28) |
| InChIKey | DCCLUPRTMLKSGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |