C17H26O2 — CID 176987638
4-[(1E,5E)-7-hydroxy-3,3,7-trimethylocta-1,5-dienyl]cyclohexa-1,5-dien-1-ol (PubChem CID 176987638) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-[(1E,5E)-7-hydroxy-3,3,7-trimethylocta-1,5-dienyl]cyclohexa-1,5-dien-1-ol.
| Compound Name | 4-[(1E,5E)-7-hydroxy-3,3,7-trimethylocta-1,5-dienyl]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 176987638 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 4-[(1E,5E)-7-hydroxy-3,3,7-trimethylocta-1,5-dienyl]cyclohexa-1,5-dien-1-ol |
| SMILES | CC(C)(O)/C=C/CC(C)(C)/C=C/C1C=CC(O)=CC1 |
| InChI | InChI=1S/C17H26O2/c1-16(2,11-5-12-17(3,4)19)13-10-14-6-8-15(18)9-7-14/h5-6,8-10,12-14,18-19H,7,11H2,1-4H3/b12-5+,13-10+ |
| InChIKey | JERSEEDZAQFBRL-SPUCVAIDSA-N |
| XLogP | 4.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|