About 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene
7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene (PubChem CID 176988750) has the molecular formula C20H22N2O4S
and a molecular weight of 386.47 g/mol. Its IUPAC name is 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene |
| PubChem CID | 176988750 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene |
| SMILES | C1=CSCC1.CNC(=O)c1cc2ccc(C3CCC3)c(C(=O)O)c2[nH]c1=O |
| InChI | InChI=1S/C16H16N2O4.C4H6S/c1-17-14(19)11-7-9-5-6-10(8-3-2-4-8)12(16(21)22)13(9)18-15(11)20;1-2-4-5-3-1/h5-8H,2-4H2,1H3,(H,17,19)(H,18,20)(H,21,22);1,3H,2,4H2 |
| InChIKey | RMTGEVBABSPQFQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene?
The IUPAC name of 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene (CID 176988750) is 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene.
What is the SMILES notation for 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene?
The canonical SMILES for 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene is C1=CSCC1.CNC(=O)c1cc2ccc(C3CCC3)c(C(=O)O)c2[nH]c1=O.
What is the InChIKey of 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene?
The InChIKey is RMTGEVBABSPQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4.C4H6S/c1-17-14(19)11-7-9-5-6-10(8-3-2-4-8)12(16(21)22)13(9)18-15(11)20;1-2-4-5-3-1/h5-8H,2-4H2,1H3,(H,17,19)(H,18,20)(H,21,22);1,3H,2,4H2.
What are the key properties of 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene?
7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene has a molecular weight of 386.47 g/mol, XLogP of 3.49, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclobutyl-3-(methylcarbamoyl)-2-oxo-1H-quinoline-8-carboxylic acid;2,3-dihydrothiophene is sourced from PubChem (CID 176988750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).