About 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide
7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 176988893) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide |
| PubChem CID | 176988893 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(c2ccc3cc(C(N)=O)c(=O)[nH]c3c2)C1 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2)7-11(8-16)9-3-4-10-5-12(14(17)19)15(20)18-13(10)6-9/h3-6,11H,7-8H2,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | HPEMCOKAHDSKLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide?
The IUPAC name of 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide (CID 176988893) is 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide.
What is the SMILES notation for 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide?
The canonical SMILES for 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide is CC1(C)CC(c2ccc3cc(C(N)=O)c(=O)[nH]c3c2)C1.
What is the InChIKey of 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide?
The InChIKey is HPEMCOKAHDSKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-16(2)7-11(8-16)9-3-4-10-5-12(14(17)19)15(20)18-13(10)6-9/h3-6,11H,7-8H2,1-2H3,(H2,17,19)(H,18,20).
What are the key properties of 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide?
7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide has a molecular weight of 270.33 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,3-dimethylcyclobutyl)-2-oxo-1H-quinoline-3-carboxamide is sourced from PubChem (CID 176988893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).