C28H35ClN10O3 — CID 176989817
N'-[amino(methyl)amino]-6-chloro-3-[1-[3-[1-(2-hydroxyacetyl)piperidin-4-yl]-4,7-dimethyl-5-oxoimidazo[1,5-a]quinazolin-9-yl]ethylamino]pyridine-2-carboximidamide (PubChem CID 176989817) has the molecular formula C28H35ClN10O3 and a molecular weight of 595.11 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-6-chloro-3-[1-[3-[1-(2-hydroxyacetyl)piperidin-4-yl]-4,7-dimethyl-5-oxoimidazo[1,5-a]quinazolin-9-yl]ethylamino]pyridine-2-carboximidamide.
| Compound Name | N'-[amino(methyl)amino]-6-chloro-3-[1-[3-[1-(2-hydroxyacetyl)piperidin-4-yl]-4,7-dimethyl-5-oxoimidazo[1,5-a]quinazolin-9-yl]ethylamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 176989817 |
| Molecular Formula | C28H35ClN10O3 |
| Molecular Weight | 595.11 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N'-[amino(methyl)amino]-6-chloro-3-[1-[3-[1-(2-hydroxyacetyl)piperidin-4-yl]-4,7-dimethyl-5-oxoimidazo[1,5-a]quinazolin-9-yl]ethylamino]pyridine-2-carboximidamide |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2/C(N)=N/N(C)N)c2c(c1)c(=O)n(C)c1c(C3CCN(C(=O)CO)CC3)ncn21 |
| InChI | InChI=1S/C28H35ClN10O3/c1-15-11-18(16(2)33-20-5-6-21(29)34-24(20)26(30)35-37(4)31)25-19(12-15)28(42)36(3)27-23(32-14-39(25)27)17-7-9-38(10-8-17)22(41)13-40/h5-6,11-12,14,16-17,33,40H,7-10,13,31H2,1-4H3,(H2,30,35) |
| InChIKey | QGHXZRPIFZUNIO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|