About ethane;methoxymethane;5-methylpyridine-2-carbonitrile
ethane;methoxymethane;5-methylpyridine-2-carbonitrile (PubChem CID 176990243) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;methoxymethane;5-methylpyridine-2-carbonitrile.
Molecular Properties
| Compound Name | ethane;methoxymethane;5-methylpyridine-2-carbonitrile |
| PubChem CID | 176990243 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;methoxymethane;5-methylpyridine-2-carbonitrile |
| SMILES | CC.COC.Cc1ccc(C#N)nc1 |
| InChI | InChI=1S/C7H6N2.C2H6O.C2H6/c1-6-2-3-7(4-8)9-5-6;1-3-2;1-2/h2-3,5H,1H3;1-2H3;1-2H3 |
| InChIKey | KYSKLKWQSPTZNN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methoxymethane;5-methylpyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethane;5-methylpyridine-2-carbonitrile?
The IUPAC name of ethane;methoxymethane;5-methylpyridine-2-carbonitrile (CID 176990243) is ethane;methoxymethane;5-methylpyridine-2-carbonitrile.
What is the SMILES notation for ethane;methoxymethane;5-methylpyridine-2-carbonitrile?
The canonical SMILES for ethane;methoxymethane;5-methylpyridine-2-carbonitrile is CC.COC.Cc1ccc(C#N)nc1.
What is the InChIKey of ethane;methoxymethane;5-methylpyridine-2-carbonitrile?
The InChIKey is KYSKLKWQSPTZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H6O.C2H6/c1-6-2-3-7(4-8)9-5-6;1-3-2;1-2/h2-3,5H,1H3;1-2H3;1-2H3.
What are the key properties of ethane;methoxymethane;5-methylpyridine-2-carbonitrile?
ethane;methoxymethane;5-methylpyridine-2-carbonitrile has a molecular weight of 194.28 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethane;5-methylpyridine-2-carbonitrile is sourced from PubChem (CID 176990243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).