C24H32N4O2S — CID 176990354
benzene;3-N-[3-[2-(4-methylsulfonylphenyl)propylamino]propyl]pyridine-2,3-diamine (PubChem CID 176990354) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is benzene;3-N-[3-[2-(4-methylsulfonylphenyl)propylamino]propyl]pyridine-2,3-diamine.
| Compound Name | benzene;3-N-[3-[2-(4-methylsulfonylphenyl)propylamino]propyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 176990354 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | benzene;3-N-[3-[2-(4-methylsulfonylphenyl)propylamino]propyl]pyridine-2,3-diamine |
| SMILES | CC(CNCCCNc1cccnc1N)c1ccc(S(C)(=O)=O)cc1.c1ccccc1 |
| InChI | InChI=1S/C18H26N4O2S.C6H6/c1-14(15-6-8-16(9-7-15)25(2,23)24)13-20-10-4-12-21-17-5-3-11-22-18(17)19;1-2-4-6-5-3-1/h3,5-9,11,14,20-21H,4,10,12-13H2,1-2H3,(H2,19,22);1-6H |
| InChIKey | DPMZGZKHCYRENI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|