About 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane
4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane (PubChem CID 176990452) has the molecular formula C13H21BrO
and a molecular weight of 273.21 g/mol. Its IUPAC name is 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane.
Molecular Properties
| Compound Name | 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane |
| PubChem CID | 176990452 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane |
| SMILES | CCCOC.CCc1cc(Br)ccc1C |
| InChI | InChI=1S/C9H11Br.C4H10O/c1-3-8-6-9(10)5-4-7(8)2;1-3-4-5-2/h4-6H,3H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | VUBFPYJGHAPBTM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane?
The IUPAC name of 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane (CID 176990452) is 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane.
What is the SMILES notation for 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane?
The canonical SMILES for 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane is CCCOC.CCc1cc(Br)ccc1C.
What is the InChIKey of 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane?
The InChIKey is VUBFPYJGHAPBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Br.C4H10O/c1-3-8-6-9(10)5-4-7(8)2;1-3-4-5-2/h4-6H,3H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane?
4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane has a molecular weight of 273.21 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethyl-1-methylbenzene;1-methoxypropane is sourced from PubChem (CID 176990452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).