C20H24N4O3S — CID 176990555
tert-butyl N-[(1S)-2-[(3R)-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]-1-phenyl-2-sulfanylethyl]carbamate (PubChem CID 176990555) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(3R)-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]-1-phenyl-2-sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(3R)-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]-1-phenyl-2-sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 176990555 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(3R)-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]-1-phenyl-2-sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)C(S)[C@@H]1Nc2ncccc2NC1=O |
| InChI | InChI=1S/C20H24N4O3S/c1-20(2,3)27-19(26)24-14(12-8-5-4-6-9-12)16(28)15-18(25)22-13-10-7-11-21-17(13)23-15/h4-11,14-16,28H,1-3H3,(H,21,23)(H,22,25)(H,24,26)/t14-,15-,16?/m0/s1 |
| InChIKey | OWDLHGJUAPXOQE-KSCSMHSMSA-N |
| XLogP | 3.38 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|