About 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole
4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole (PubChem CID 176990582) has the molecular formula C13H12F3NO3
and a molecular weight of 287.24 g/mol. Its IUPAC name is 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole |
| PubChem CID | 176990582 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole |
| SMILES | COCCc1ccc(OC(F)(F)F)c(-c2cnoc2)c1 |
| InChI | InChI=1S/C13H12F3NO3/c1-18-5-4-9-2-3-12(20-13(14,15)16)11(6-9)10-7-17-19-8-10/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | HRPUNZUTEZNNED-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole?
The IUPAC name of 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole (CID 176990582) is 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole.
What is the SMILES notation for 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole?
The canonical SMILES for 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole is COCCc1ccc(OC(F)(F)F)c(-c2cnoc2)c1.
What is the InChIKey of 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole?
The InChIKey is HRPUNZUTEZNNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO3/c1-18-5-4-9-2-3-12(20-13(14,15)16)11(6-9)10-7-17-19-8-10/h2-3,6-8H,4-5H2,1H3.
What are the key properties of 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole?
4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole has a molecular weight of 287.24 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2-methoxyethyl)-2-(trifluoromethoxy)phenyl]-1,2-oxazole is sourced from PubChem (CID 176990582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).