C17H20ClN5O2 — CID 176991131
3-[[2-(6-chloro-3-pyridinyl)propylamino]methyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxamide (PubChem CID 176991131) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 3-[[2-(6-chloro-3-pyridinyl)propylamino]methyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxamide.
| Compound Name | 3-[[2-(6-chloro-3-pyridinyl)propylamino]methyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxamide |
|---|---|
| PubChem CID | 176991131 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[[2-(6-chloro-3-pyridinyl)propylamino]methyl]-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxamide |
| SMILES | CC(CNCC1CNc2cc(C(N)=O)cnc2O1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-10(11-2-3-15(18)22-6-11)5-20-8-13-9-21-14-4-12(16(19)24)7-23-17(14)25-13/h2-4,6-7,10,13,20-21H,5,8-9H2,1H3,(H2,19,24) |
| InChIKey | BKFNHHOPFFMSEA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|