C10H20N2O — CID 176992533
3-[(dimethylamino)methyl]-5-propan-2-ylpyrrolidin-2-one (PubChem CID 176992533) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-5-propan-2-ylpyrrolidin-2-one.
| Compound Name | 3-[(dimethylamino)methyl]-5-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 176992533 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-[(dimethylamino)methyl]-5-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)C1CC(CN(C)C)C(=O)N1 |
| InChI | InChI=1S/C10H20N2O/c1-7(2)9-5-8(6-12(3)4)10(13)11-9/h7-9H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | YMEWXNBBCNYZPL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |