About ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine
ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine (PubChem CID 176992778) has the molecular formula C20H39NO2
and a molecular weight of 325.54 g/mol. Its IUPAC name is ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine.
Molecular Properties
| Compound Name | ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine |
| PubChem CID | 176992778 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine |
| SMILES | C=C/C=C\C(=C)OCCOCCN1CCC(C)CC1.CC.CC |
| InChI | InChI=1S/C16H27NO2.2C2H6/c1-4-5-6-16(3)19-14-13-18-12-11-17-9-7-15(2)8-10-17;2*1-2/h4-6,15H,1,3,7-14H2,2H3;2*1-2H3/b6-5-;; |
| InChIKey | VQTGYCHLUWXCTQ-XNOMRPDFSA-N |
| XLogP | 5.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine?
The IUPAC name of ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine (CID 176992778) is ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine.
What is the SMILES notation for ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine?
The canonical SMILES for ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine is C=C/C=C\C(=C)OCCOCCN1CCC(C)CC1.CC.CC.
What is the InChIKey of ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine?
The InChIKey is VQTGYCHLUWXCTQ-XNOMRPDFSA-N. The full InChI is InChI=1S/C16H27NO2.2C2H6/c1-4-5-6-16(3)19-14-13-18-12-11-17-9-7-15(2)8-10-17;2*1-2/h4-6,15H,1,3,7-14H2,2H3;2*1-2H3/b6-5-;;.
What are the key properties of ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine?
ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine has a molecular weight of 325.54 g/mol, XLogP of 5.06, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]ethyl]-4-methylpiperidine is sourced from PubChem (CID 176992778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).