About 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile
2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile (PubChem CID 176993532) has the molecular formula C9H7BF3N3OS
and a molecular weight of 273.05 g/mol. Its IUPAC name is 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile |
| PubChem CID | 176993532 |
| Molecular Formula | C9H7BF3N3OS |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile |
| SMILES | N#CB1CCN(c2nc(C(F)(F)F)cs2)C(=O)C1 |
| InChI | InChI=1S/C9H7BF3N3OS/c11-9(12,13)6-4-18-8(15-6)16-2-1-10(5-14)3-7(16)17/h4H,1-3H2 |
| InChIKey | CVSZJVGHNGYKBV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile?
The IUPAC name of 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile (CID 176993532) is 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile.
What is the SMILES notation for 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile?
The canonical SMILES for 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile is N#CB1CCN(c2nc(C(F)(F)F)cs2)C(=O)C1.
What is the InChIKey of 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile?
The InChIKey is CVSZJVGHNGYKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BF3N3OS/c11-9(12,13)6-4-18-8(15-6)16-2-1-10(5-14)3-7(16)17/h4H,1-3H2.
What are the key properties of 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile?
2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile has a molecular weight of 273.05 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,4-azaborinane-4-carbonitrile is sourced from PubChem (CID 176993532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).