C25H27F3N6OS3 — CID 176993616
N-[4-[4-[5-cyano-4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]formamide;N,2-dimethyl-N-methylsulfanylaniline (PubChem CID 176993616) has the molecular formula C25H27F3N6OS3 and a molecular weight of 580.73 g/mol. Its IUPAC name is N-[4-[4-[5-cyano-4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]formamide;N,2-dimethyl-N-methylsulfanylaniline.
| Compound Name | N-[4-[4-[5-cyano-4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]formamide;N,2-dimethyl-N-methylsulfanylaniline |
|---|---|
| PubChem CID | 176993616 |
| Molecular Formula | C25H27F3N6OS3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | N-[4-[4-[5-cyano-4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanylphenyl]formamide;N,2-dimethyl-N-methylsulfanylaniline |
| SMILES | CSN(C)c1ccccc1C.N#Cc1sc(N2CCN(Sc3ccc(NC=O)cc3)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3N5OS2.C9H13NS/c17-16(18,19)14-13(9-20)26-15(22-14)23-5-7-24(8-6-23)27-12-3-1-11(2-4-12)21-10-25;1-8-6-4-5-7-9(8)10(2)11-3/h1-4,10H,5-8H2,(H,21,25);4-7H,1-3H3 |
| InChIKey | XCEXYYRYVXVXCR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|