C38H22N2O — CID 176994431
4-[6-(3-cyanophenyl)dibenzofuran-4-yl]-2,6-diphenylbenzonitrile (PubChem CID 176994431) has the molecular formula C38H22N2O and a molecular weight of 522.61 g/mol. Its IUPAC name is 4-[6-(3-cyanophenyl)dibenzofuran-4-yl]-2,6-diphenylbenzonitrile.
| Compound Name | 4-[6-(3-cyanophenyl)dibenzofuran-4-yl]-2,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 176994431 |
| Molecular Formula | C38H22N2O |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-[6-(3-cyanophenyl)dibenzofuran-4-yl]-2,6-diphenylbenzonitrile |
| SMILES | N#Cc1cccc(-c2cccc3c2oc2c(-c4cc(-c5ccccc5)c(C#N)c(-c5ccccc5)c4)cccc23)c1 |
| InChI | InChI=1S/C38H22N2O/c39-23-25-10-7-15-28(20-25)30-16-8-18-32-33-19-9-17-31(38(33)41-37(30)32)29-21-34(26-11-3-1-4-12-26)36(24-40)35(22-29)27-13-5-2-6-14-27/h1-22H |
| InChIKey | BJXROXWKGMKZLG-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |