C23H41N3 — CID 176994919
1,4-diethyl-7-[[4-(2-methylprop-2-enyl)phenyl]methyl]-1,4,7-triazonane;ethane (PubChem CID 176994919) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 1,4-diethyl-7-[[4-(2-methylprop-2-enyl)phenyl]methyl]-1,4,7-triazonane;ethane.
| Compound Name | 1,4-diethyl-7-[[4-(2-methylprop-2-enyl)phenyl]methyl]-1,4,7-triazonane;ethane |
|---|---|
| PubChem CID | 176994919 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 1,4-diethyl-7-[[4-(2-methylprop-2-enyl)phenyl]methyl]-1,4,7-triazonane;ethane |
| SMILES | C=C(C)Cc1ccc(CN2CCN(CC)CCN(CC)CC2)cc1.CC |
| InChI | InChI=1S/C21H35N3.C2H6/c1-5-22-11-12-23(6-2)14-16-24(15-13-22)18-21-9-7-20(8-10-21)17-19(3)4;1-2/h7-10H,3,5-6,11-18H2,1-2,4H3;1-2H3 |
| InChIKey | ZCPNPPCRXNVGMN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|