C17H22NOP — CID 176995355
1-phenyl-1-phosphanyl-N-[(2-propan-2-yloxyphenyl)methyl]methanamine (PubChem CID 176995355) has the molecular formula C17H22NOP and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-phenyl-1-phosphanyl-N-[(2-propan-2-yloxyphenyl)methyl]methanamine.
| Compound Name | 1-phenyl-1-phosphanyl-N-[(2-propan-2-yloxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 176995355 |
| Molecular Formula | C17H22NOP |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-phenyl-1-phosphanyl-N-[(2-propan-2-yloxyphenyl)methyl]methanamine |
| SMILES | CC(C)Oc1ccccc1CNC(P)c1ccccc1 |
| InChI | InChI=1S/C17H22NOP/c1-13(2)19-16-11-7-6-10-15(16)12-18-17(20)14-8-4-3-5-9-14/h3-11,13,17-18H,12,20H2,1-2H3 |
| InChIKey | DIWFQCHMQNSAAB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|