About formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate
formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate (PubChem CID 176995754) has the molecular formula C13H28N2O4S2
and a molecular weight of 340.51 g/mol. Its IUPAC name is formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate.
Molecular Properties
| Compound Name | formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate |
| PubChem CID | 176995754 |
| Molecular Formula | C13H28N2O4S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate |
| SMILES | C=O.COCCN(C)CCSSCCN(C)CCOC=O |
| InChI | InChI=1S/C12H26N2O3S2.CH2O/c1-13(4-8-16-3)6-10-18-19-11-7-14(2)5-9-17-12-15;1-2/h12H,4-11H2,1-3H3;1H2 |
| InChIKey | BYPKLLIHCHHLJN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate?
The IUPAC name of formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate (CID 176995754) is formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate.
What is the SMILES notation for formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate?
The canonical SMILES for formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate is C=O.COCCN(C)CCSSCCN(C)CCOC=O.
What is the InChIKey of formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate?
The InChIKey is BYPKLLIHCHHLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3S2.CH2O/c1-13(4-8-16-3)6-10-18-19-11-7-14(2)5-9-17-12-15;1-2/h12H,4-11H2,1-3H3;1H2.
What are the key properties of formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate?
formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate has a molecular weight of 340.51 g/mol, XLogP of 0.87, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-[2-[2-[2-methoxyethyl(methyl)amino]ethyldisulfanyl]ethyl-methylamino]ethyl formate is sourced from PubChem (CID 176995754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).