C26H35N5O — CID 176995918
3-[3-[(3aS,7aS)-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]phenyl]propanamide (PubChem CID 176995918) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 3-[3-[(3aS,7aS)-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]phenyl]propanamide.
| Compound Name | 3-[3-[(3aS,7aS)-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 176995918 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 3-[3-[(3aS,7aS)-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]phenyl]propanamide |
| SMILES | NC(=O)CCc1cccc(N2CCC[C@H]3[C@@H]2CCN3c2cc(N3CCCCC3)ccn2)c1 |
| InChI | InChI=1S/C26H35N5O/c27-25(32)10-9-20-6-4-7-22(18-20)30-16-5-8-23-24(30)12-17-31(23)26-19-21(11-13-28-26)29-14-2-1-3-15-29/h4,6-7,11,13,18-19,23-24H,1-3,5,8-10,12,14-17H2,(H2,27,32)/t23-,24-/m0/s1 |
| InChIKey | DWWRKGZWUUIHCP-ZEQRLZLVSA-N |
| XLogP | 3.74 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |