About 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane
7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane (PubChem CID 176996079) has the molecular formula C14H15ClFNO2
and a molecular weight of 283.73 g/mol. Its IUPAC name is 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane.
Molecular Properties
| Compound Name | 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane |
| PubChem CID | 176996079 |
| Molecular Formula | C14H15ClFNO2 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane |
| SMILES | CC.O=c1[nH]c2c(F)c(CCl)ccc2c2c1CCO2 |
| InChI | InChI=1S/C12H9ClFNO2.C2H6/c13-5-6-1-2-7-10(9(6)14)15-12(16)8-3-4-17-11(7)8;1-2/h1-2H,3-5H2,(H,15,16);1-2H3 |
| InChIKey | MSLMRZFFHHQQBS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane?
The IUPAC name of 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane (CID 176996079) is 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane.
What is the SMILES notation for 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane?
The canonical SMILES for 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane is CC.O=c1[nH]c2c(F)c(CCl)ccc2c2c1CCO2.
What is the InChIKey of 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane?
The InChIKey is MSLMRZFFHHQQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClFNO2.C2H6/c13-5-6-1-2-7-10(9(6)14)15-12(16)8-3-4-17-11(7)8;1-2/h1-2H,3-5H2,(H,15,16);1-2H3.
What are the key properties of 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane?
7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane has a molecular weight of 283.73 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-6-fluoro-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one;ethane is sourced from PubChem (CID 176996079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).