C10H13F3O6S — CID 176996413
ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-5-carboxylate (PubChem CID 176996413) has the molecular formula C10H13F3O6S and a molecular weight of 318.27 g/mol. Its IUPAC name is ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 176996413 |
| Molecular Formula | C10H13F3O6S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC(C)OC1 |
| InChI | InChI=1S/C10H13F3O6S/c1-3-17-9(14)7-5-18-6(2)4-8(7)19-20(15,16)10(11,12)13/h6H,3-5H2,1-2H3 |
| InChIKey | YXNQLGKBGINZDV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|