C22H25F5N2O4 — CID 176996497
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-(2-methoxyethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 176996497) has the molecular formula C22H25F5N2O4 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-(2-methoxyethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-(2-methoxyethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 176996497 |
| Molecular Formula | C22H25F5N2O4 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-(2-methoxyethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | COCCc1c(C)nc([C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)[nH]c1=O |
| InChI | InChI=1S/C22H25F5N2O4/c1-10-15(13-6-7-14(23)16(24)17(13)32-5)18(33-21(10,3)22(25,26)27)19-28-11(2)12(8-9-31-4)20(30)29-19/h6-7,10,15,18H,8-9H2,1-5H3,(H,28,29,30)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | VORWAJVNYGVBEG-TZDAZOALSA-N |
| XLogP | 4.37 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |