About 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one
1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one (PubChem CID 176996572) has the molecular formula C19H25F2NO3
and a molecular weight of 353.41 g/mol. Its IUPAC name is 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one |
| PubChem CID | 176996572 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one |
| SMILES | CO.Cc1cc(=O)cc(C2CCC(C)O2)[nH]1.Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H15NO2.C7H6F2.CH4O/c1-7-5-9(13)6-10(12-7)11-4-3-8(2)14-11;1-5-3-2-4-6(8)7(5)9;1-2/h5-6,8,11H,3-4H2,1-2H3,(H,12,13);2-4H,1H3;2H,1H3 |
| InChIKey | VXKSRUPFJDMTEI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one?
The IUPAC name of 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one (CID 176996572) is 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one.
What is the SMILES notation for 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one?
The canonical SMILES for 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one is CO.Cc1cc(=O)cc(C2CCC(C)O2)[nH]1.Cc1cccc(F)c1F.
What is the InChIKey of 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one?
The InChIKey is VXKSRUPFJDMTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C7H6F2.CH4O/c1-7-5-9(13)6-10(12-7)11-4-3-8(2)14-11;1-5-3-2-4-6(8)7(5)9;1-2/h5-6,8,11H,3-4H2,1-2H3,(H,12,13);2-4H,1H3;2H,1H3.
What are the key properties of 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one?
1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one has a molecular weight of 353.41 g/mol, XLogP of 3.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-methylbenzene;methanol;2-methyl-6-(5-methyloxolan-2-yl)-1H-pyridin-4-one is sourced from PubChem (CID 176996572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).