C21H22F5NO3 — CID 176996631
6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methylphenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-2,3-dimethyl-1H-pyridin-4-one (PubChem CID 176996631) has the molecular formula C21H22F5NO3 and a molecular weight of 431.40 g/mol. Its IUPAC name is 6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methylphenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-2,3-dimethyl-1H-pyridin-4-one.
| Compound Name | 6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methylphenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-2,3-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 176996631 |
| Molecular Formula | C21H22F5NO3 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methylphenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-2,3-dimethyl-1H-pyridin-4-one |
| SMILES | CO[C@H]1[C@@H](c2ccc(F)c(F)c2C)[C@H](c2cc(=O)c(C)c(C)[nH]2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C21H22F5NO3/c1-9-11(3)27-14(8-15(9)28)18-16(12-6-7-13(22)17(23)10(12)2)19(29-5)20(4,30-18)21(24,25)26/h6-8,16,18-19H,1-5H3,(H,27,28)/t16-,18-,19-,20+/m0/s1 |
| InChIKey | XYHPWUVXXQOGOF-FRYIKTPZSA-N |
| XLogP | 4.77 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |