C30H38ClN3O3 — CID 176997147
3-(3-chloro-2-methylphenyl)-3-[[3,3-dimethyl-1-(oxan-4-ylmethyl)-2-oxoindol-6-yl]amino]azetidine-1-carbaldehyde;prop-1-ene (PubChem CID 176997147) has the molecular formula C30H38ClN3O3 and a molecular weight of 524.11 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-3-[[3,3-dimethyl-1-(oxan-4-ylmethyl)-2-oxoindol-6-yl]amino]azetidine-1-carbaldehyde;prop-1-ene.
| Compound Name | 3-(3-chloro-2-methylphenyl)-3-[[3,3-dimethyl-1-(oxan-4-ylmethyl)-2-oxoindol-6-yl]amino]azetidine-1-carbaldehyde;prop-1-ene |
|---|---|
| PubChem CID | 176997147 |
| Molecular Formula | C30H38ClN3O3 |
| Molecular Weight | 524.11 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-3-[[3,3-dimethyl-1-(oxan-4-ylmethyl)-2-oxoindol-6-yl]amino]azetidine-1-carbaldehyde;prop-1-ene |
| SMILES | C=CC.Cc1c(Cl)cccc1C1(Nc2ccc3c(c2)N(CC2CCOCC2)C(=O)C3(C)C)CN(C=O)C1 |
| InChI | InChI=1S/C27H32ClN3O3.C3H6/c1-18-21(5-4-6-23(18)28)27(15-30(16-27)17-32)29-20-7-8-22-24(13-20)31(25(33)26(22,2)3)14-19-9-11-34-12-10-19;1-3-2/h4-8,13,17,19,29H,9-12,14-16H2,1-3H3;3H,1H2,2H3 |
| InChIKey | SBWQANMQZPGMLY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.11 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|