About 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one
7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one (PubChem CID 176997307) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one |
| PubChem CID | 176997307 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one |
| SMILES | COCCn1ccc2ccc(NC3(c4cccc(C)c4C)CNC3)cc2c1=O |
| InChI | InChI=1S/C23H27N3O2/c1-16-5-4-6-21(17(16)2)23(14-24-15-23)25-19-8-7-18-9-10-26(11-12-28-3)22(27)20(18)13-19/h4-10,13,24-25H,11-12,14-15H2,1-3H3 |
| InChIKey | PLGPCNQGQZYEEE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one?
The IUPAC name of 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one (CID 176997307) is 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one.
What is the SMILES notation for 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one?
The canonical SMILES for 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one is COCCn1ccc2ccc(NC3(c4cccc(C)c4C)CNC3)cc2c1=O.
What is the InChIKey of 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one?
The InChIKey is PLGPCNQGQZYEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-16-5-4-6-21(17(16)2)23(14-24-15-23)25-19-8-7-18-9-10-26(11-12-28-3)22(27)20(18)13-19/h4-10,13,24-25H,11-12,14-15H2,1-3H3.
What are the key properties of 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one?
7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one has a molecular weight of 377.49 g/mol, XLogP of 3.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[3-(2,3-dimethylphenyl)azetidin-3-yl]amino]-2-(2-methoxyethyl)isoquinolin-1-one is sourced from PubChem (CID 176997307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).