About 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one
6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 176997437) has the molecular formula C11H11FN2O
and a molecular weight of 206.22 g/mol. Its IUPAC name is 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| PubChem CID | 176997437 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(CC2)c2c(F)cc(N)cc21 |
| InChI | InChI=1S/C11H11FN2O/c1-14-8-5-6(13)4-7(12)9(8)11(2-3-11)10(14)15/h4-5H,2-3,13H2,1H3 |
| InChIKey | RYVNPPDWSALZOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The IUPAC name of 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (CID 176997437) is 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
What is the SMILES notation for 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The canonical SMILES for 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one is CN1C(=O)C2(CC2)c2c(F)cc(N)cc21.
What is the InChIKey of 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The InChIKey is RYVNPPDWSALZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O/c1-14-8-5-6(13)4-7(12)9(8)11(2-3-11)10(14)15/h4-5H,2-3,13H2,1H3.
What are the key properties of 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one has a molecular weight of 206.22 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-amino-4'-fluoro-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one is sourced from PubChem (CID 176997437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).