C28H35ClF3N3O2 — CID 176997449
6-[[3-(3-chloro-2-methylphenyl)-1-methylazetidin-3-yl]amino]-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane;prop-2-enal (PubChem CID 176997449) has the molecular formula C28H35ClF3N3O2 and a molecular weight of 538.05 g/mol. Its IUPAC name is 6-[[3-(3-chloro-2-methylphenyl)-1-methylazetidin-3-yl]amino]-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane;prop-2-enal.
| Compound Name | 6-[[3-(3-chloro-2-methylphenyl)-1-methylazetidin-3-yl]amino]-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane;prop-2-enal |
|---|---|
| PubChem CID | 176997449 |
| Molecular Formula | C28H35ClF3N3O2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 6-[[3-(3-chloro-2-methylphenyl)-1-methylazetidin-3-yl]amino]-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane;prop-2-enal |
| SMILES | C=CC=O.CC.Cc1c(Cl)cccc1C1(Nc2ccc3c(c2)N(CC(F)(F)F)C(=O)C3(C)C)CN(C)C1 |
| InChI | InChI=1S/C23H25ClF3N3O.C3H4O.C2H6/c1-14-16(6-5-7-18(14)24)22(11-29(4)12-22)28-15-8-9-17-19(10-15)30(13-23(25,26)27)20(31)21(17,2)3;1-2-3-4;1-2/h5-10,28H,11-13H2,1-4H3;2-3H,1H2;1-2H3 |
| InChIKey | AXJXRJMPBBSRBF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|