C22H26Cl2FN5O — CID 176997465
6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-3-propan-2-ylpyrido[3,2-d]pyrimidin-4-one;ethane (PubChem CID 176997465) has the molecular formula C22H26Cl2FN5O and a molecular weight of 466.39 g/mol. Its IUPAC name is 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-3-propan-2-ylpyrido[3,2-d]pyrimidin-4-one;ethane.
| Compound Name | 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-3-propan-2-ylpyrido[3,2-d]pyrimidin-4-one;ethane |
|---|---|
| PubChem CID | 176997465 |
| Molecular Formula | C22H26Cl2FN5O |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 6-[[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-3-yl]amino]-3-propan-2-ylpyrido[3,2-d]pyrimidin-4-one;ethane |
| SMILES | CC.CC(C)n1cnc2ccc(NC3(c4c(F)ccc(Cl)c4Cl)CCNC3)nc2c1=O |
| InChI | InChI=1S/C20H20Cl2FN5O.C2H6/c1-11(2)28-10-25-14-5-6-15(26-18(14)19(28)29)27-20(7-8-24-9-20)16-13(23)4-3-12(21)17(16)22;1-2/h3-6,10-11,24H,7-9H2,1-2H3,(H,26,27);1-2H3 |
| InChIKey | VQKZLFSTELWLQF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|