About ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide
ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide (PubChem CID 176997908) has the molecular formula C11H20N2OS
and a molecular weight of 228.36 g/mol. Its IUPAC name is ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide |
| PubChem CID | 176997908 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide |
| SMILES | CC.CCNC(=O)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C9H14N2OS.C2H6/c1-4-10-8(12)9-11-7(5-13-9)6(2)3;1-2/h5-6H,4H2,1-3H3,(H,10,12);1-2H3 |
| InChIKey | HRLYBUPSSJZZPD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide?
The IUPAC name of ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide (CID 176997908) is ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide?
The canonical SMILES for ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide is CC.CCNC(=O)c1nc(C(C)C)cs1.
What is the InChIKey of ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide?
The InChIKey is HRLYBUPSSJZZPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS.C2H6/c1-4-10-8(12)9-11-7(5-13-9)6(2)3;1-2/h5-6H,4H2,1-3H3,(H,10,12);1-2H3.
What are the key properties of ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide?
ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide has a molecular weight of 228.36 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-4-propan-2-yl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 176997908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).