About ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide
ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide (PubChem CID 176997970) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide |
| PubChem CID | 176997970 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide |
| SMILES | CC.CC.CNC(=O)c1nc(OC)cnc1C |
| InChI | InChI=1S/C8H11N3O2.2C2H6/c1-5-7(8(12)9-2)11-6(13-3)4-10-5;2*1-2/h4H,1-3H3,(H,9,12);2*1-2H3 |
| InChIKey | XPRCAOHQNHNTDD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide?
The IUPAC name of ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide (CID 176997970) is ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide.
What is the SMILES notation for ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide?
The canonical SMILES for ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide is CC.CC.CNC(=O)c1nc(OC)cnc1C.
What is the InChIKey of ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide?
The InChIKey is XPRCAOHQNHNTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2.2C2H6/c1-5-7(8(12)9-2)11-6(13-3)4-10-5;2*1-2/h4H,1-3H3,(H,9,12);2*1-2H3.
What are the key properties of ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide?
ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide has a molecular weight of 241.33 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methoxy-N,3-dimethylpyrazine-2-carboxamide is sourced from PubChem (CID 176997970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).