About ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide
ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 176998035) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 176998035 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CC.CCNC(=O)c1sc(C(C)C)nc1C |
| InChI | InChI=1S/C10H16N2OS.C2H6/c1-5-11-9(13)8-7(4)12-10(14-8)6(2)3;1-2/h6H,5H2,1-4H3,(H,11,13);1-2H3 |
| InChIKey | CLSUHMMBEMDQIN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide (CID 176998035) is ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide is CC.CCNC(=O)c1sc(C(C)C)nc1C.
What is the InChIKey of ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The InChIKey is CLSUHMMBEMDQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS.C2H6/c1-5-11-9(13)8-7(4)12-10(14-8)6(2)3;1-2/h6H,5H2,1-4H3,(H,11,13);1-2H3.
What are the key properties of ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide has a molecular weight of 242.39 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 176998035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).