About N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen
N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen (PubChem CID 176998060) has the molecular formula C10H18N2OS
and a molecular weight of 214.33 g/mol. Its IUPAC name is N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen |
| PubChem CID | 176998060 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen |
| SMILES | CC(C)NC(=O)c1nc(C(C)C)cs1.[H][H] |
| InChI | InChI=1S/C10H16N2OS.H2/c1-6(2)8-5-14-10(12-8)9(13)11-7(3)4;/h5-7H,1-4H3,(H,11,13);1H |
| InChIKey | NMTWDMFIJUDQIR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen?
The IUPAC name of N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen (CID 176998060) is N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen.
What is the SMILES notation for N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen?
The canonical SMILES for N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen is CC(C)NC(=O)c1nc(C(C)C)cs1.[H][H].
What is the InChIKey of N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen?
The InChIKey is NMTWDMFIJUDQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS.H2/c1-6(2)8-5-14-10(12-8)9(13)11-7(3)4;/h5-7H,1-4H3,(H,11,13);1H.
What are the key properties of N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen?
N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen has a molecular weight of 214.33 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 176998060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).