C10H16N2OS — CID 176998061
N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 176998061) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 176998061 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N,4-di(propan-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)NC(=O)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C10H16N2OS/c1-6(2)8-5-14-10(12-8)9(13)11-7(3)4/h5-7H,1-4H3,(H,11,13) |
| InChIKey | LADCMNGMAAWJEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |