About 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol
4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol (PubChem CID 176999975) has the molecular formula C16H29NOS
and a molecular weight of 283.48 g/mol. Its IUPAC name is 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol.
Molecular Properties
| Compound Name | 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol |
| PubChem CID | 176999975 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol |
| SMILES | CC(C)(C)C(C)(C)O.CC(C)Sc1ccc(N)cc1 |
| InChI | InChI=1S/C9H13NS.C7H16O/c1-7(2)11-9-5-3-8(10)4-6-9;1-6(2,3)7(4,5)8/h3-7H,10H2,1-2H3;8H,1-5H3 |
| InChIKey | KVACPRPJPXAFGG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol?
The IUPAC name of 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol (CID 176999975) is 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol.
What is the SMILES notation for 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol?
The canonical SMILES for 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol is CC(C)(C)C(C)(C)O.CC(C)Sc1ccc(N)cc1.
What is the InChIKey of 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol?
The InChIKey is KVACPRPJPXAFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.C7H16O/c1-7(2)11-9-5-3-8(10)4-6-9;1-6(2,3)7(4,5)8/h3-7H,10H2,1-2H3;8H,1-5H3.
What are the key properties of 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol?
4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol has a molecular weight of 283.48 g/mol, XLogP of 4.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol is sourced from PubChem (CID 176999975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).