C16H29NOS — CID 176999975
4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol (PubChem CID 176999975) has the molecular formula C16H29NOS and a molecular weight of 283.48 g/mol. Its IUPAC name is 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol.
| Compound Name | 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol |
|---|---|
| PubChem CID | 176999975 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4-propan-2-ylsulfanylaniline;2,3,3-trimethylbutan-2-ol |
| SMILES | CC(C)(C)C(C)(C)O.CC(C)Sc1ccc(N)cc1 |
| InChI | InChI=1S/C9H13NS.C7H16O/c1-7(2)11-9-5-3-8(10)4-6-9;1-6(2,3)7(4,5)8/h3-7H,10H2,1-2H3;8H,1-5H3 |
| InChIKey | KVACPRPJPXAFGG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|