About 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine
4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 177000540) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 177000540 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CCC1=C(C)C(F)C(N)C=C1C |
| InChI | InChI=1S/C10H16FN/c1-4-8-6(2)5-9(12)10(11)7(8)3/h5,9-10H,4,12H2,1-3H3 |
| InChIKey | GEIAWKWHPBREFE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine (CID 177000540) is 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine is CCC1=C(C)C(F)C(N)C=C1C.
What is the InChIKey of 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is GEIAWKWHPBREFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FN/c1-4-8-6(2)5-9(12)10(11)7(8)3/h5,9-10H,4,12H2,1-3H3.
What are the key properties of 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine?
4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 169.24 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-fluoro-3,5-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 177000540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).