C15H13Cl2N5O3 — CID 177001296
2-(2,6-dichloropurin-7-yl)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 177001296) has the molecular formula C15H13Cl2N5O3 and a molecular weight of 382.21 g/mol. Its IUPAC name is 2-(2,6-dichloropurin-7-yl)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2,6-dichloropurin-7-yl)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 177001296 |
| Molecular Formula | C15H13Cl2N5O3 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-(2,6-dichloropurin-7-yl)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cnc3nc(Cl)nc(Cl)c32)cc1OC |
| InChI | InChI=1S/C15H13Cl2N5O3/c1-24-9-4-3-8(5-10(9)25-2)19-11(23)6-22-7-18-14-12(22)13(16)20-15(17)21-14/h3-5,7H,6H2,1-2H3,(H,19,23) |
| InChIKey | JCWICFOLNXXTGS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |