C18H35N — CID 177001359
ethane;(5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine (PubChem CID 177001359) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is ethane;(5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine.
| Compound Name | ethane;(5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
|---|---|
| PubChem CID | 177001359 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | ethane;(5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
| SMILES | C=C/C=C(\C=C/C)C(C)(C)C(C)(N)C(C)(C)C.CC |
| InChI | InChI=1S/C16H29N.C2H6/c1-9-11-13(12-10-2)15(6,7)16(8,17)14(3,4)5;1-2/h9-12H,1,17H2,2-8H3;1-2H3/b12-10-,13-11+; |
| InChIKey | QDYSXJCMUYJOCK-XBSYKESISA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|