C13H16N2O — CID 177001392
5-[(3E)-5-cyclopropylhexa-1,3,5-trien-3-yl]-3-ethyl-1,2,4-oxadiazole (PubChem CID 177001392) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-[(3E)-5-cyclopropylhexa-1,3,5-trien-3-yl]-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-[(3E)-5-cyclopropylhexa-1,3,5-trien-3-yl]-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 177001392 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-[(3E)-5-cyclopropylhexa-1,3,5-trien-3-yl]-3-ethyl-1,2,4-oxadiazole |
| SMILES | C=C/C(=C\C(=C)C1CC1)c1nc(CC)no1 |
| InChI | InChI=1S/C13H16N2O/c1-4-10(8-9(3)11-6-7-11)13-14-12(5-2)15-16-13/h4,8,11H,1,3,5-7H2,2H3/b10-8+ |
| InChIKey | DALDBWLTKLQVDN-CSKARUKUSA-N |
| XLogP | 3.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|