C29H52O — CID 177001463
1-[(3S,8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethanone;molecular hydrogen (PubChem CID 177001463) has the molecular formula C29H52O and a molecular weight of 416.73 g/mol. Its IUPAC name is 1-[(3S,8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethanone;molecular hydrogen.
| Compound Name | 1-[(3S,8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethanone;molecular hydrogen |
|---|---|
| PubChem CID | 177001463 |
| Molecular Formula | C29H52O |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.40 |
| IUPAC Name | 1-[(3S,8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethanone;molecular hydrogen |
| SMILES | CC(=O)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1.[H][H].[H][H] |
| InChI | InChI=1S/C29H48O.2H2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-23-18-22(21(4)30)14-16-28(23,5)27(24)15-17-29(25,26)6;;/h10,19-20,22,24-27H,7-9,11-18H2,1-6H3;2*1H/t20-,22+,24+,25-,26?,27?,28+,29-;;/m1../s1 |
| InChIKey | OBYHJIQBJSEGQF-IDEQAUTPSA-N |
| XLogP | 8.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|