C11H18N2O — CID 177002203
N-[2-methyl-5-(methylamino)hexa-1,3,5-trien-3-yl]propanamide (PubChem CID 177002203) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[2-methyl-5-(methylamino)hexa-1,3,5-trien-3-yl]propanamide.
| Compound Name | N-[2-methyl-5-(methylamino)hexa-1,3,5-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 177002203 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-[2-methyl-5-(methylamino)hexa-1,3,5-trien-3-yl]propanamide |
| SMILES | C=C(C=C(NC(=O)CC)C(=C)C)NC |
| InChI | InChI=1S/C11H18N2O/c1-6-11(14)13-10(8(2)3)7-9(4)12-5/h7,12H,2,4,6H2,1,3,5H3,(H,13,14) |
| InChIKey | YLULWIKAUDBYAQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|