C35H55N4+ — CID 177002206
(3Z,5Z)-4-N-[3-[1-[2-(benzylamino)prop-2-enyl]azepan-1-ium-1-yl]prop-1-en-2-yl]-2-N-(cyclohexylmethyl)-3,5-dimethylhepta-1,3,5-triene-2,4-diamine (PubChem CID 177002206) has the molecular formula C35H55N4+ and a molecular weight of 531.85 g/mol. Its IUPAC name is (3Z,5Z)-4-N-[3-[1-[2-(benzylamino)prop-2-enyl]azepan-1-ium-1-yl]prop-1-en-2-yl]-2-N-(cyclohexylmethyl)-3,5-dimethylhepta-1,3,5-triene-2,4-diamine.
| Compound Name | (3Z,5Z)-4-N-[3-[1-[2-(benzylamino)prop-2-enyl]azepan-1-ium-1-yl]prop-1-en-2-yl]-2-N-(cyclohexylmethyl)-3,5-dimethylhepta-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 177002206 |
| Molecular Formula | C35H55N4+ |
| Molecular Weight | 531.85 g/mol |
| Exact Mass | 531.44 |
| IUPAC Name | (3Z,5Z)-4-N-[3-[1-[2-(benzylamino)prop-2-enyl]azepan-1-ium-1-yl]prop-1-en-2-yl]-2-N-(cyclohexylmethyl)-3,5-dimethylhepta-1,3,5-triene-2,4-diamine |
| SMILES | C=C(C[N+]1(CC(=C)NC(/C(C)=C\C)=C(/C)C(=C)NCC2CCCCC2)CCCCCC1)NCc1ccccc1 |
| InChI | InChI=1S/C35H55N4/c1-7-28(2)35(31(5)32(6)37-25-34-20-14-11-15-21-34)38-30(4)27-39(22-16-8-9-17-23-39)26-29(3)36-24-33-18-12-10-13-19-33/h7,10,12-13,18-19,34,36-38H,3-4,6,8-9,11,14-17,20-27H2,1-2,5H3/q+1/b28-7-,35-31- |
| InChIKey | MUFYZGGKICLFIN-WUVGKUHISA-N |
| XLogP | 7.71 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.85 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|