About CID 177002302
CID 177002302 (PubChem CID 177002302) has the molecular formula C19H29BN2O3S+
and a molecular weight of 376.33 g/mol.
Molecular Properties
| Compound Name | CID 177002302 |
| PubChem CID | 177002302 |
| Molecular Formula | C19H29BN2O3S+ |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | — |
| SMILES | [B]=C(OC)c1scc(C)c1NC(=O)C[N+]1(CC(C)=O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C19H28BN2O3S/c1-13-12-26-17(18(20)25-5)16(13)21-15(24)11-22(10-14(2)23)8-6-19(3,4)7-9-22/h12H,6-11H2,1-5H3/p+1 |
| InChIKey | XTTDZUIIAUPQPP-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 177002302 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177002302?
The IUPAC name of CID 177002302 (CID 177002302) is not available.
What is the SMILES notation for CID 177002302?
The canonical SMILES for CID 177002302 is [B]=C(OC)c1scc(C)c1NC(=O)C[N+]1(CC(C)=O)CCC(C)(C)CC1.
What is the InChIKey of CID 177002302?
The InChIKey is XTTDZUIIAUPQPP-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H28BN2O3S/c1-13-12-26-17(18(20)25-5)16(13)21-15(24)11-22(10-14(2)23)8-6-19(3,4)7-9-22/h12H,6-11H2,1-5H3/p+1.
What are the key properties of CID 177002302?
CID 177002302 has a molecular weight of 376.33 g/mol, XLogP of 2.51, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177002302 is sourced from PubChem (CID 177002302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).