C37H60O8 — CID 177002455
(6R,9E,15E)-11-[(6R)-4-hydroxy-6-methyloxan-2-yl]oxy-5-(4-hydroxy-3-methyl-6-oxooctyl)-6,16,18-trimethyl-4,21-dioxabicyclo[15.3.1]henicosa-9,15,18-trien-3-one (PubChem CID 177002455) has the molecular formula C37H60O8 and a molecular weight of 632.88 g/mol. Its IUPAC name is (6R,9E,15E)-11-[(6R)-4-hydroxy-6-methyloxan-2-yl]oxy-5-(4-hydroxy-3-methyl-6-oxooctyl)-6,16,18-trimethyl-4,21-dioxabicyclo[15.3.1]henicosa-9,15,18-trien-3-one.
| Compound Name | (6R,9E,15E)-11-[(6R)-4-hydroxy-6-methyloxan-2-yl]oxy-5-(4-hydroxy-3-methyl-6-oxooctyl)-6,16,18-trimethyl-4,21-dioxabicyclo[15.3.1]henicosa-9,15,18-trien-3-one |
|---|---|
| PubChem CID | 177002455 |
| Molecular Formula | C37H60O8 |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.43 |
| IUPAC Name | (6R,9E,15E)-11-[(6R)-4-hydroxy-6-methyloxan-2-yl]oxy-5-(4-hydroxy-3-methyl-6-oxooctyl)-6,16,18-trimethyl-4,21-dioxabicyclo[15.3.1]henicosa-9,15,18-trien-3-one |
| SMILES | CCC(=O)CC(O)C(C)CCC1OC(=O)CC2CC=C(C)C(O2)/C(C)=C/CCCC(OC2CC(O)C[C@@H](C)O2)/C=C/CC[C@H]1C |
| InChI | InChI=1S/C37H60O8/c1-7-29(38)21-33(40)24(2)17-19-34-25(3)12-8-10-14-31(43-36-22-30(39)20-28(6)42-36)15-11-9-13-26(4)37-27(5)16-18-32(44-37)23-35(41)45-34/h10,13-14,16,24-25,28,30-34,36-37,39-40H,7-9,11-12,15,17-23H2,1-6H3/b14-10+,26-13+/t24?,25-,28-,30?,31?,32?,33?,34?,36?,37?/m1/s1 |
| InChIKey | MKVIDXPPDNIWPD-BUTCMHBBSA-N |
| XLogP | 6.91 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|