C16H19N3O4 — CID 177003139
N-formyl-N-methyl-2-[4-(methylamino)-1,3-dioxoisoindol-2-yl]pentanamide (PubChem CID 177003139) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-formyl-N-methyl-2-[4-(methylamino)-1,3-dioxoisoindol-2-yl]pentanamide.
| Compound Name | N-formyl-N-methyl-2-[4-(methylamino)-1,3-dioxoisoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 177003139 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-formyl-N-methyl-2-[4-(methylamino)-1,3-dioxoisoindol-2-yl]pentanamide |
| SMILES | CCCC(C(=O)N(C)C=O)N1C(=O)c2cccc(NC)c2C1=O |
| InChI | InChI=1S/C16H19N3O4/c1-4-6-12(15(22)18(3)9-20)19-14(21)10-7-5-8-11(17-2)13(10)16(19)23/h5,7-9,12,17H,4,6H2,1-3H3 |
| InChIKey | UMDQJUWGDGKCBP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|