C7H5ClN2O3S — CID 177003358
5-chloro-2-methyl-1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one (PubChem CID 177003358) has the molecular formula C7H5ClN2O3S and a molecular weight of 232.65 g/mol. Its IUPAC name is 5-chloro-2-methyl-1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one.
| Compound Name | 5-chloro-2-methyl-1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one |
|---|---|
| PubChem CID | 177003358 |
| Molecular Formula | C7H5ClN2O3S |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 5-chloro-2-methyl-1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one |
| SMILES | CN1C(=O)c2nc(Cl)ccc2S1(=O)=O |
| InChI | InChI=1S/C7H5ClN2O3S/c1-10-7(11)6-4(14(10,12)13)2-3-5(8)9-6/h2-3H,1H3 |
| InChIKey | VWMKSUXJWAVFAO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|